C10H14N2O5S — CID 70364906
1-[(2R,4S)-4-(methylsulfonylmethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70364906) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-[(2R,4S)-4-(methylsulfonylmethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-4-(methylsulfonylmethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70364906 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-[(2R,4S)-4-(methylsulfonylmethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CS(=O)(=O)C[C@@H]1CO[C@@H](n2ccc(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C10H14N2O5S/c1-18(15,16)6-7-4-9(17-5-7)12-3-2-8(13)11-10(12)14/h2-3,7,9H,4-6H2,1H3,(H,11,13,14)/t7-,9+/m0/s1 |
| InChIKey | VJUMFTFZSMYRQC-IONNQARKSA-N |
| XLogP | -0.88 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |