C25H33FN4O8 — CID 110154110
tert-butyl N-[3-[3-[[(1R,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]carbamoyl]phenoxy]propyl]carbamate (PubChem CID 110154110) has the molecular formula C25H33FN4O8 and a molecular weight of 536.56 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[(1R,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]carbamoyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[(1R,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]carbamoyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 110154110 |
| Molecular Formula | C25H33FN4O8 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | tert-butyl N-[3-[3-[[(1R,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclohexyl]carbamoyl]phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1cccc(C(=O)N[C@@H]2CC[C@@H](n3cc(F)c(=O)[nH]c3=O)[C@@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C25H33FN4O8/c1-25(2,3)38-24(36)27-10-5-11-37-15-7-4-6-14(12-15)21(33)28-17-8-9-18(20(32)19(17)31)30-13-16(26)22(34)29-23(30)35/h4,6-7,12-13,17-20,31-32H,5,8-11H2,1-3H3,(H,27,36)(H,28,33)(H,29,34,35)/t17-,18-,19-,20-/m1/s1 |
| InChIKey | GXUFXVDSIHWCCQ-UAFMIMERSA-N |
| XLogP | 0.82 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|