C26H31FN2O5Si — CID 173401981
1-[(2S,4S,5R)-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione (PubChem CID 173401981) has the molecular formula C26H31FN2O5Si and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-[(2S,4S,5R)-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5R)-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173401981 |
| Molecular Formula | C26H31FN2O5Si |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[(2S,4S,5R)-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)(C)OC[C@H]1O[C@](n2cc(CF)c(=O)[nH]c2=O)([SiH](c2ccccc2)c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C26H31FN2O5Si/c1-25(2,3)33-17-22-21(30)14-26(34-22,29-16-18(15-27)23(31)28-24(29)32)35(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,16,21-22,30,35H,14-15,17H2,1-3H3,(H,28,31,32)/t21-,22+,26-/m0/s1 |
| InChIKey | QRSYNAVLTOPVDT-VRUMLPLGSA-N |
| XLogP | 1.20 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|