C10H14N2O4S — CID 87305898
1-[(2S,5S)-5-(hydroxymethyl)-2-sulfanyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 87305898) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[(2S,5S)-5-(hydroxymethyl)-2-sulfanyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-5-(hydroxymethyl)-2-sulfanyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87305898 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-[(2S,5S)-5-(hydroxymethyl)-2-sulfanyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@]2(S)CC[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4S/c1-6-4-12(9(15)11-8(6)14)10(17)3-2-7(5-13)16-10/h4,7,13,17H,2-3,5H2,1H3,(H,11,14,15)/t7-,10-/m0/s1 |
| InChIKey | LJXHMHCWVZKXHJ-XVKPBYJWSA-N |
| XLogP | -0.44 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|