C26H28FNO3 — CID 170087757
[(2R,3S,4S,5S)-3-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-5-methyloxolan-2-yl]methanol (PubChem CID 170087757) has the molecular formula C26H28FNO3 and a molecular weight of 421.51 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-5-methyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5S)-3-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-5-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 170087757 |
| Molecular Formula | C26H28FNO3 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | [(2R,3S,4S,5S)-3-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-5-methyloxolan-2-yl]methanol |
| SMILES | COc1ccc(C(N[C@@H]2[C@H](F)[C@@H](CO)O[C@H]2C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28FNO3/c1-18-25(24(27)23(17-29)31-18)28-26(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(30-2)16-14-21/h3-16,18,23-25,28-29H,17H2,1-2H3/t18-,23+,24+,25-/m0/s1 |
| InChIKey | HUINRGYVVVWKER-YCXHYSRHSA-N |
| XLogP | 4.06 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|