C31H32FN5O5 — CID 123421532
9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2,3-dihydro-1H-purin-6-one (PubChem CID 123421532) has the molecular formula C31H32FN5O5 and a molecular weight of 573.63 g/mol. Its IUPAC name is 9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2,3-dihydro-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2,3-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 123421532 |
| Molecular Formula | C31H32FN5O5 |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2,3-dihydro-1H-purin-6-one |
| SMILES | COc1ccc(C(NC2NC(=O)c3ncn([C@@H]4O[C@H](CO)[C@@H](F)[C@@]4(C)O)c3N2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32FN5O5/c1-30(40)25(32)23(17-38)42-28(30)37-18-33-24-26(37)34-29(35-27(24)39)36-31(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(41-2)16-14-21/h3-16,18,23,25,28-29,34,36,38,40H,17H2,1-2H3,(H,35,39)/t23-,25-,28-,29?,30-/m1/s1 |
| InChIKey | KSRXPOBYHQPRQU-KOSLNCISSA-N |
| XLogP | 2.89 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|