C14H17N3O6 — CID 70365622
4-amino-1-[(2S,4S,5R)-2,4-diacetyl-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one (PubChem CID 70365622) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is 4-amino-1-[(2S,4S,5R)-2,4-diacetyl-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,4S,5R)-2,4-diacetyl-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 70365622 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-amino-1-[(2S,4S,5R)-2,4-diacetyl-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one |
| SMILES | C=C1[C@@](O)(C(C)=O)[C@@H](CO)O[C@@]1(C(C)=O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C14H17N3O6/c1-7-13(22,8(2)19)10(6-18)23-14(7,9(3)20)17-5-4-11(15)16-12(17)21/h4-5,10,18,22H,1,6H2,2-3H3,(H2,15,16,21)/t10-,13-,14+/m1/s1 |
| InChIKey | QAAVYTTXVLELQS-HONMWMINSA-N |
| XLogP | -1.67 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|