C14H22FN3O5 — CID 174545877
4-amino-1-[(2S,3R,4R,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)-3-pentyloxolan-2-yl]pyrimidin-2-one (PubChem CID 174545877) has the molecular formula C14H22FN3O5 and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-amino-1-[(2S,3R,4R,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)-3-pentyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,3R,4R,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)-3-pentyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 174545877 |
| Molecular Formula | C14H22FN3O5 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-amino-1-[(2S,3R,4R,5R)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)-3-pentyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CCCCC[C@@]1(O)[C@H](O)[C@@H](CO)O[C@@]1(F)n1ccc(N)nc1=O |
| InChI | InChI=1S/C14H22FN3O5/c1-2-3-4-6-13(22)11(20)9(8-19)23-14(13,15)18-7-5-10(16)17-12(18)21/h5,7,9,11,19-20,22H,2-4,6,8H2,1H3,(H2,16,17,21)/t9-,11-,13-,14+/m1/s1 |
| InChIKey | OEALARDULVOWHO-IMJCEVDSSA-N |
| XLogP | -0.53 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|