C11H12FN3O6 — CID 70674778
(2R,3R,4R,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile (PubChem CID 70674778) has the molecular formula C11H12FN3O6 and a molecular weight of 301.23 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile.
| Compound Name | (2R,3R,4R,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile |
|---|---|
| PubChem CID | 70674778 |
| Molecular Formula | C11H12FN3O6 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2R,3R,4R,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@@]1(C#N)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H12FN3O6/c1-10(20)7(17)6(3-16)21-11(10,4-13)15-2-5(12)8(18)14-9(15)19/h2,6-7,16-17,20H,3H2,1H3,(H,14,18,19)/t6-,7-,10-,11-/m1/s1 |
| InChIKey | NVCAEBUJBGWGOL-JJHYMCDRSA-N |
| XLogP | -2.64 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |