C19H27FN2O9 — CID 139668027
[2-[(2S,4S,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]acetyl] 3-butoxybutanoate (PubChem CID 139668027) has the molecular formula C19H27FN2O9 and a molecular weight of 446.43 g/mol. Its IUPAC name is [2-[(2S,4S,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]acetyl] 3-butoxybutanoate.
| Compound Name | [2-[(2S,4S,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]acetyl] 3-butoxybutanoate |
|---|---|
| PubChem CID | 139668027 |
| Molecular Formula | C19H27FN2O9 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [2-[(2S,4S,5R)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]acetyl] 3-butoxybutanoate |
| SMILES | CCCCOC(C)CC(=O)OC(=O)C[C@]1(n2cc(F)c(=O)[nH]c2=O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C19H27FN2O9/c1-3-4-5-29-11(2)6-15(25)30-16(26)8-19(7-13(24)14(10-23)31-19)22-9-12(20)17(27)21-18(22)28/h9,11,13-14,23-24H,3-8,10H2,1-2H3,(H,21,27,28)/t11?,13-,14+,19-/m0/s1 |
| InChIKey | WIEZUDNQFVRJFX-ZKNQBMDYSA-N |
| XLogP | -0.47 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|