C33H51FN2O11 — CID 22838881
2-[3-[(2R,3S,5R)-3-(3-carboxyundecanoyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-3-hydroxy-2-oxopropyl]decanoic acid (PubChem CID 22838881) has the molecular formula C33H51FN2O11 and a molecular weight of 670.77 g/mol. Its IUPAC name is 2-[3-[(2R,3S,5R)-3-(3-carboxyundecanoyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-3-hydroxy-2-oxopropyl]decanoic acid.
| Compound Name | 2-[3-[(2R,3S,5R)-3-(3-carboxyundecanoyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-3-hydroxy-2-oxopropyl]decanoic acid |
|---|---|
| PubChem CID | 22838881 |
| Molecular Formula | C33H51FN2O11 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | 2-[3-[(2R,3S,5R)-3-(3-carboxyundecanoyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-3-hydroxy-2-oxopropyl]decanoic acid |
| SMILES | CCCCCCCCC(CC(=O)C(O)[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@]1(O)C(=O)CC(CCCCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C33H51FN2O11/c1-3-5-7-9-11-13-15-21(30(41)42)17-24(37)27(39)28-33(46,19-26(47-28)36-20-23(34)29(40)35-32(36)45)25(38)18-22(31(43)44)16-14-12-10-8-6-4-2/h20-22,26-28,39,46H,3-19H2,1-2H3,(H,41,42)(H,43,44)(H,35,40,45)/t21?,22?,26-,27?,28-,33-/m1/s1 |
| InChIKey | UUZAFILKPWMMDJ-FVFJMPOSSA-N |
| XLogP | 3.88 |
| TPSA | 213.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|