C15H22FN2O7P — CID 139330975
1-[(4aR,6R,7aS)-2-hexoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 139330975) has the molecular formula C15H22FN2O7P and a molecular weight of 392.32 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2-hexoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-2-hexoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139330975 |
| Molecular Formula | C15H22FN2O7P |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2-hexoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CCCCCCOP1(=O)OC[C@H]2O[C@@H](n3cc(F)c(=O)[nH]c3=O)C[C@@H]2O1 |
| InChI | InChI=1S/C15H22FN2O7P/c1-2-3-4-5-6-22-26(21)23-9-12-11(25-26)7-13(24-12)18-8-10(16)14(19)17-15(18)20/h8,11-13H,2-7,9H2,1H3,(H,17,19,20)/t11-,12+,13+,26?/m0/s1 |
| InChIKey | ISLWHNNMOJQUJR-HNOINHCRSA-N |
| XLogP | 2.08 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|