C16H15F2N2O7P — CID 139331287
1-[(4aR,6R,7aS)-2-[(3-fluorophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 139331287) has the molecular formula C16H15F2N2O7P and a molecular weight of 416.27 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2-[(3-fluorophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-2-[(3-fluorophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139331287 |
| Molecular Formula | C16H15F2N2O7P |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2-[(3-fluorophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@@H]3OP(=O)(OCc4cccc(F)c4)OC[C@H]3O2)cc1F |
| InChI | InChI=1S/C16H15F2N2O7P/c17-10-3-1-2-9(4-10)7-24-28(23)25-8-13-12(27-28)5-14(26-13)20-6-11(18)15(21)19-16(20)22/h1-4,6,12-14H,5,7-8H2,(H,19,21,22)/t12-,13+,14+,28?/m0/s1 |
| InChIKey | ZXNDJDYCJDAWDF-VWIRTGDQSA-N |
| XLogP | 1.84 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|