C17H17F2N2O7P — CID 155410294
1-[(4aR,6R,7aS)-2-[2-(3-fluorophenyl)ethoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 155410294) has the molecular formula C17H17F2N2O7P and a molecular weight of 430.30 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2-[2-(3-fluorophenyl)ethoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-2-[2-(3-fluorophenyl)ethoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155410294 |
| Molecular Formula | C17H17F2N2O7P |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2-[2-(3-fluorophenyl)ethoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@@H]3OP(=O)(OCCc4cccc(F)c4)OC[C@H]3O2)cc1F |
| InChI | InChI=1S/C17H17F2N2O7P/c18-11-3-1-2-10(6-11)4-5-25-29(24)26-9-14-13(28-29)7-15(27-14)21-8-12(19)16(22)20-17(21)23/h1-3,6,8,13-15H,4-5,7,9H2,(H,20,22,23)/t13-,14+,15+,29?/m0/s1 |
| InChIKey | HJFQCNGQKVDYSS-SYRLMVSXSA-N |
| XLogP | 1.89 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|