C19H20F2NO7P — CID 158920573
1-[(4aR,6R,7aS)-2-[3-(2-fluorophenyl)propoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione (PubChem CID 158920573) has the molecular formula C19H20F2NO7P and a molecular weight of 443.34 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-2-[3-(2-fluorophenyl)propoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-2-[3-(2-fluorophenyl)propoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione |
|---|---|
| PubChem CID | 158920573 |
| Molecular Formula | C19H20F2NO7P |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 1-[(4aR,6R,7aS)-2-[3-(2-fluorophenyl)propoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyridine-2,4-dione |
| SMILES | O=C1CC(=O)N([C@H]2C[C@@H]3OP(=O)(OCCCc4ccccc4F)OC[C@H]3O2)C=C1F |
| InChI | InChI=1S/C19H20F2NO7P/c20-13-6-2-1-4-12(13)5-3-7-26-30(25)27-11-17-16(29-30)9-19(28-17)22-10-14(21)15(23)8-18(22)24/h1-2,4,6,10,16-17,19H,3,5,7-9,11H2/t16-,17+,19+,30?/m0/s1 |
| InChIKey | JHTZIOWOIQRDSX-UABYUBKUSA-N |
| XLogP | 3.03 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|