C21H28NO9P — CID 157117773
propan-2-yl 5-[[(2S,4aR,6R,7R,7aS)-6-(2,4-dioxo-1-pyridinyl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate (PubChem CID 157117773) has the molecular formula C21H28NO9P and a molecular weight of 469.43 g/mol. Its IUPAC name is propan-2-yl 5-[[(2S,4aR,6R,7R,7aS)-6-(2,4-dioxo-1-pyridinyl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate.
| Compound Name | propan-2-yl 5-[[(2S,4aR,6R,7R,7aS)-6-(2,4-dioxo-1-pyridinyl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate |
|---|---|
| PubChem CID | 157117773 |
| Molecular Formula | C21H28NO9P |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | propan-2-yl 5-[[(2S,4aR,6R,7R,7aS)-6-(2,4-dioxo-1-pyridinyl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate |
| SMILES | C#C[C@]1(C)[C@@H]2O[P@@](=O)(OCCCCC(=O)OC(C)C)OC[C@H]2O[C@H]1N1C=CC(=O)CC1=O |
| InChI | InChI=1S/C21H28NO9P/c1-5-21(4)19-16(30-20(21)22-10-9-15(23)12-17(22)24)13-28-32(26,31-19)27-11-7-6-8-18(25)29-14(2)3/h1,9-10,14,16,19-20H,6-8,11-13H2,2-4H3/t16-,19-,20-,21-,32+/m1/s1 |
| InChIKey | QCBVQEAQZSBCRN-ILVPOQFISA-N |
| XLogP | 2.33 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|