C19H27N4O9P — CID 160755660
propan-2-yl 4-[[(2R,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate (PubChem CID 160755660) has the molecular formula C19H27N4O9P and a molecular weight of 486.42 g/mol. Its IUPAC name is propan-2-yl 4-[[(2R,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate.
| Compound Name | propan-2-yl 4-[[(2R,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 160755660 |
| Molecular Formula | C19H27N4O9P |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | propan-2-yl 4-[[(2R,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
| SMILES | CC(C)OC(=O)C(C)CCO[P@]1(=O)OC[C@H]2O[C@@H](N3C=CC(=O)CC3=O)[C@](C)(N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C19H27N4O9P/c1-11(2)30-17(26)12(3)6-8-28-33(27)29-10-14-16(32-33)19(4,21-22-20)18(31-14)23-7-5-13(24)9-15(23)25/h5,7,11-12,14,16,18H,6,8-10H2,1-4H3/t12?,14-,16-,18-,19-,33-/m1/s1 |
| InChIKey | QEFRQISEAYAGRT-PPXMMJNKSA-N |
| XLogP | 2.61 |
| TPSA | 166.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|