C20H29N2O9P — CID 159373401
cyclopentyl 4-[[(2R,4aR,6R,7R,7aS)-7-amino-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]butanoate (PubChem CID 159373401) has the molecular formula C20H29N2O9P and a molecular weight of 472.43 g/mol. Its IUPAC name is cyclopentyl 4-[[(2R,4aR,6R,7R,7aS)-7-amino-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]butanoate.
| Compound Name | cyclopentyl 4-[[(2R,4aR,6R,7R,7aS)-7-amino-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]butanoate |
|---|---|
| PubChem CID | 159373401 |
| Molecular Formula | C20H29N2O9P |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | cyclopentyl 4-[[(2R,4aR,6R,7R,7aS)-7-amino-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]butanoate |
| SMILES | C[C@@]1(N)[C@@H]2O[P@](=O)(OCCCC(=O)OC3CCCC3)OC[C@H]2O[C@H]1N1C=CC(=O)CC1=O |
| InChI | InChI=1S/C20H29N2O9P/c1-20(21)18-15(30-19(20)22-9-8-13(23)11-16(22)24)12-28-32(26,31-18)27-10-4-7-17(25)29-14-5-2-3-6-14/h8-9,14-15,18-19H,2-7,10-12,21H2,1H3/t15-,18-,19-,20-,32-/m1/s1 |
| InChIKey | KHAZWYYTARUEFX-MGDNRUATSA-N |
| XLogP | 1.55 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|