C17H26FN3O7 — CID 129449637
(2R)-2-[(2R,3R,4S,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-heptyl-2-hydroxyacetamide (PubChem CID 129449637) has the molecular formula C17H26FN3O7 and a molecular weight of 403.41 g/mol. Its IUPAC name is (2R)-2-[(2R,3R,4S,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-heptyl-2-hydroxyacetamide.
| Compound Name | (2R)-2-[(2R,3R,4S,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-heptyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 129449637 |
| Molecular Formula | C17H26FN3O7 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (2R)-2-[(2R,3R,4S,5S)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-heptyl-2-hydroxyacetamide |
| SMILES | CCCCCCCNC(=O)[C@H](O)[C@@H]1O[C@H](n2cc(F)c(=O)[nH]c2=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H26FN3O7/c1-2-3-4-5-6-7-19-15(26)12(24)13-10(22)11(23)16(28-13)21-8-9(18)14(25)20-17(21)27/h8,10-13,16,22-24H,2-7H2,1H3,(H,19,26)(H,20,25,27)/t10-,11+,12-,13-,16+/m1/s1 |
| InChIKey | DMXGKTWTDFFUGU-FSPSUXSGSA-N |
| XLogP | -1.26 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|