C18H29BrN2O6Si — CID 173088850
5-(2-bromoethenyl)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[hydroxy(methoxy)methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 173088850) has the molecular formula C18H29BrN2O6Si and a molecular weight of 477.43 g/mol. Its IUPAC name is 5-(2-bromoethenyl)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[hydroxy(methoxy)methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(2-bromoethenyl)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[hydroxy(methoxy)methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173088850 |
| Molecular Formula | C18H29BrN2O6Si |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 5-(2-bromoethenyl)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[hydroxy(methoxy)methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC(O)[C@H]1O[C@@H](n2cc(C=CBr)c(=O)[nH]c2=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29BrN2O6Si/c1-18(2,3)28(5,6)27-12-9-13(26-14(12)16(23)25-4)21-10-11(7-8-19)15(22)20-17(21)24/h7-8,10,12-14,16,23H,9H2,1-6H3,(H,20,22,24)/t12-,13+,14-,16?/m0/s1 |
| InChIKey | YWSBHIVNRJZNJT-OJEWEXDKSA-N |
| XLogP | 2.54 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|