C26H27BrN2O7 — CID 88725647
1-[(2R,4S,5R)-4-benzylperoxy-5-(1-benzylperoxyethyl)oxolan-2-yl]-5-[(E)-2-bromoethenyl]pyrimidine-2,4-dione (PubChem CID 88725647) has the molecular formula C26H27BrN2O7 and a molecular weight of 559.41 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-benzylperoxy-5-(1-benzylperoxyethyl)oxolan-2-yl]-5-[(E)-2-bromoethenyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-benzylperoxy-5-(1-benzylperoxyethyl)oxolan-2-yl]-5-[(E)-2-bromoethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88725647 |
| Molecular Formula | C26H27BrN2O7 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | 1-[(2R,4S,5R)-4-benzylperoxy-5-(1-benzylperoxyethyl)oxolan-2-yl]-5-[(E)-2-bromoethenyl]pyrimidine-2,4-dione |
| SMILES | CC(OOCc1ccccc1)[C@H]1O[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)C[C@@H]1OOCc1ccccc1 |
| InChI | InChI=1S/C26H27BrN2O7/c1-18(35-32-16-19-8-4-2-5-9-19)24-22(36-33-17-20-10-6-3-7-11-20)14-23(34-24)29-15-21(12-13-27)25(30)28-26(29)31/h2-13,15,18,22-24H,14,16-17H2,1H3,(H,28,30,31)/b13-12+/t18?,22-,23+,24+/m0/s1 |
| InChIKey | WICYMDCQFGXNGG-QZVBHYGSSA-N |
| XLogP | 4.24 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|