C27H28BrN4O11P — CID 58664004
benzyl (2S)-2-[[[(2R,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate (PubChem CID 58664004) has the molecular formula C27H28BrN4O11P and a molecular weight of 695.42 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58664004 |
| Molecular Formula | C27H28BrN4O11P |
| Molecular Weight | 695.42 g/mol |
| Exact Mass | 694.07 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)CC1O)Oc1ccc([N+](=O)[O-])cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28BrN4O11P/c1-17(26(35)40-15-18-5-3-2-4-6-18)30-44(39,43-21-9-7-20(8-10-21)32(37)38)41-16-23-22(33)13-24(42-23)31-14-19(11-12-28)25(34)29-27(31)36/h2-12,14,17,22-24,33H,13,15-16H2,1H3,(H,30,39)(H,29,34,36)/b12-11+/t17-,22?,23+,24+,44?/m0/s1 |
| InChIKey | VYEAMCNXRUDZDS-YCPMIWBNSA-N |
| XLogP | 3.38 |
| TPSA | 201.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|