C23H35N3O5Si — CID 15476584
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(phenylmethoxyamino)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 15476584) has the molecular formula C23H35N3O5Si and a molecular weight of 461.64 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(phenylmethoxyamino)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(phenylmethoxyamino)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15476584 |
| Molecular Formula | C23H35N3O5Si |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(phenylmethoxyamino)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CNOCc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H35N3O5Si/c1-16-14-26(22(28)25-21(16)27)20-12-18(31-32(5,6)23(2,3)4)19(30-20)13-24-29-15-17-10-8-7-9-11-17/h7-11,14,18-20,24H,12-13,15H2,1-6H3,(H,25,27,28)/t18-,19+,20+/m0/s1 |
| InChIKey | DIUHAYQPRCMFDW-XUVXKRRUSA-N |
| XLogP | 3.24 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|