C26H38O4Si — CID 11037593
tert-butyl-[(3S,5S)-3,5-dimethoxy-6-[(2S)-oxiran-2-yl]hexoxy]-diphenylsilane (PubChem CID 11037593) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is tert-butyl-[(3S,5S)-3,5-dimethoxy-6-[(2S)-oxiran-2-yl]hexoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3S,5S)-3,5-dimethoxy-6-[(2S)-oxiran-2-yl]hexoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11037593 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | tert-butyl-[(3S,5S)-3,5-dimethoxy-6-[(2S)-oxiran-2-yl]hexoxy]-diphenylsilane |
| SMILES | CO[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](C[C@H]1CO1)OC |
| InChI | InChI=1S/C26H38O4Si/c1-26(2,3)31(24-12-8-6-9-13-24,25-14-10-7-11-15-25)30-17-16-21(27-4)18-22(28-5)19-23-20-29-23/h6-15,21-23H,16-20H2,1-5H3/t21-,22-,23-/m0/s1 |
| InChIKey | NLMAIDWBLYHUSI-VABKMULXSA-N |
| XLogP | 4.16 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|