C25H37IOSi — CID 25001335
tert-butyl-[(2R,4R)-1-iodo-2,6-dimethylheptan-4-yl]oxy-diphenylsilane (PubChem CID 25001335) has the molecular formula C25H37IOSi and a molecular weight of 508.56 g/mol. Its IUPAC name is tert-butyl-[(2R,4R)-1-iodo-2,6-dimethylheptan-4-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,4R)-1-iodo-2,6-dimethylheptan-4-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 25001335 |
| Molecular Formula | C25H37IOSi |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | tert-butyl-[(2R,4R)-1-iodo-2,6-dimethylheptan-4-yl]oxy-diphenylsilane |
| SMILES | CC(C)C[C@H](C[C@@H](C)CI)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H37IOSi/c1-20(2)17-22(18-21(3)19-26)27-28(25(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,20-22H,17-19H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | GBQSVDKPMZQBDI-FGZHOGPDSA-N |
| XLogP | 6.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|