C21H30N2O2Si — CID 2755269
(2R)-2-amino-3-[dimethyl(phenyl)silyl]-N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylpropanamide (PubChem CID 2755269) has the molecular formula C21H30N2O2Si and a molecular weight of 370.57 g/mol. Its IUPAC name is (2R)-2-amino-3-[dimethyl(phenyl)silyl]-N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylpropanamide.
| Compound Name | (2R)-2-amino-3-[dimethyl(phenyl)silyl]-N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 2755269 |
| Molecular Formula | C21H30N2O2Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (2R)-2-amino-3-[dimethyl(phenyl)silyl]-N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylpropanamide |
| SMILES | CC(C(O)c1ccccc1)N(C)C(=O)[C@@H](N)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O2Si/c1-16(20(24)17-11-7-5-8-12-17)23(2)21(25)19(22)15-26(3,4)18-13-9-6-10-14-18/h5-14,16,19-20,24H,15,22H2,1-4H3/t16?,19-,20?/m0/s1 |
| InChIKey | GJFBXZDDLKFYFS-AJPWXKBRSA-N |
| XLogP | 2.51 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|