C39H47NO3Si — CID 140928745
(2S)-2-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide (PubChem CID 140928745) has the molecular formula C39H47NO3Si and a molecular weight of 605.90 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide.
| Compound Name | (2S)-2-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide |
|---|---|
| PubChem CID | 140928745 |
| Molecular Formula | C39H47NO3Si |
| Molecular Weight | 605.90 g/mol |
| Exact Mass | 605.33 |
| IUPAC Name | (2S)-2-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpent-4-enamide |
| SMILES | C=CC[C@@H](C[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)N(C)[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C39H47NO3Si/c1-7-20-33(38(42)40(6)36(31-21-12-8-13-22-31)37(41)32-23-14-9-15-24-32)29-30(2)43-44(39(3,4)5,34-25-16-10-17-26-34)35-27-18-11-19-28-35/h7-19,21-28,30,33,36-37,41H,1,20,29H2,2-6H3/t30-,33+,36-,37-/m1/s1 |
| InChIKey | OIWLTPCRBGLIJY-XNZYRGQOSA-N |
| XLogP | 7.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.90 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|