C11H14Cl2O2S — CID 88988664
1,5-dichloropentan-3-ylsulfonylbenzene (PubChem CID 88988664) has the molecular formula C11H14Cl2O2S and a molecular weight of 281.20 g/mol. Its IUPAC name is 1,5-dichloropentan-3-ylsulfonylbenzene.
| Compound Name | 1,5-dichloropentan-3-ylsulfonylbenzene |
|---|---|
| PubChem CID | 88988664 |
| Molecular Formula | C11H14Cl2O2S |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1,5-dichloropentan-3-ylsulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(CCCl)CCCl |
| InChI | InChI=1S/C11H14Cl2O2S/c12-8-6-11(7-9-13)16(14,15)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | XUBCQBUVFKSJIF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|