C19H25NO3S — CID 154511654
N-[(2S,3S)-1-hydroxy-5-methyl-3-phenylhexan-2-yl]benzenesulfonamide (PubChem CID 154511654) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[(2S,3S)-1-hydroxy-5-methyl-3-phenylhexan-2-yl]benzenesulfonamide.
| Compound Name | N-[(2S,3S)-1-hydroxy-5-methyl-3-phenylhexan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 154511654 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[(2S,3S)-1-hydroxy-5-methyl-3-phenylhexan-2-yl]benzenesulfonamide |
| SMILES | CC(C)C[C@@H](c1ccccc1)[C@@H](CO)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3S/c1-15(2)13-18(16-9-5-3-6-10-16)19(14-21)20-24(22,23)17-11-7-4-8-12-17/h3-12,15,18-21H,13-14H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | VDTFMQHNXXMEKG-RBUKOAKNSA-N |
| XLogP | 3.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |