C17H20BrNO3S — CID 10046401
4-bromo-N-[(2S,3R)-1-hydroxy-3-phenylpentan-2-yl]benzenesulfonamide (PubChem CID 10046401) has the molecular formula C17H20BrNO3S and a molecular weight of 398.32 g/mol. Its IUPAC name is 4-bromo-N-[(2S,3R)-1-hydroxy-3-phenylpentan-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(2S,3R)-1-hydroxy-3-phenylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10046401 |
| Molecular Formula | C17H20BrNO3S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 4-bromo-N-[(2S,3R)-1-hydroxy-3-phenylpentan-2-yl]benzenesulfonamide |
| SMILES | CC[C@H](c1ccccc1)[C@@H](CO)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrNO3S/c1-2-16(13-6-4-3-5-7-13)17(12-20)19-23(21,22)15-10-8-14(18)9-11-15/h3-11,16-17,19-20H,2,12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | YCZUORCCCJYCEV-IAGOWNOFSA-N |
| XLogP | 3.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |