C16H21BrN2O3S2 — CID 22500909
5-bromo-N-(1-hydroxy-5-methyl-3-pyridin-3-ylhexan-2-yl)thiophene-2-sulfonamide (PubChem CID 22500909) has the molecular formula C16H21BrN2O3S2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 5-bromo-N-(1-hydroxy-5-methyl-3-pyridin-3-ylhexan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1-hydroxy-5-methyl-3-pyridin-3-ylhexan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22500909 |
| Molecular Formula | C16H21BrN2O3S2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 5-bromo-N-(1-hydroxy-5-methyl-3-pyridin-3-ylhexan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)CC(c1cccnc1)C(CO)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C16H21BrN2O3S2/c1-11(2)8-13(12-4-3-7-18-9-12)14(10-20)19-24(21,22)16-6-5-15(17)23-16/h3-7,9,11,13-14,19-20H,8,10H2,1-2H3 |
| InChIKey | HXXDBMRNPGELPH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |