C14H24BrNO3S2 — CID 10200862
5-bromo-N-[(2R,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide (PubChem CID 10200862) has the molecular formula C14H24BrNO3S2 and a molecular weight of 398.39 g/mol. Its IUPAC name is 5-bromo-N-[(2R,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(2R,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10200862 |
| Molecular Formula | C14H24BrNO3S2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 5-bromo-N-[(2R,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCCCCC[C@@H](C)[C@H](CO)NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H24BrNO3S2/c1-3-4-5-6-7-11(2)12(10-17)16-21(18,19)14-9-8-13(15)20-14/h8-9,11-12,16-17H,3-7,10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | QAYDWFYVOUJKBH-NEPJUHHUSA-N |
| XLogP | 3.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|