C21H20O3 — CID 6923032
3-hydroxy-2-[(1S)-3-oxo-1-phenylhexyl]inden-1-one (PubChem CID 6923032) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-hydroxy-2-[(1S)-3-oxo-1-phenylhexyl]inden-1-one.
| Compound Name | 3-hydroxy-2-[(1S)-3-oxo-1-phenylhexyl]inden-1-one |
|---|---|
| PubChem CID | 6923032 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-hydroxy-2-[(1S)-3-oxo-1-phenylhexyl]inden-1-one |
| SMILES | CCCC(=O)C[C@H](C1=C(O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O3/c1-2-8-15(22)13-18(14-9-4-3-5-10-14)19-20(23)16-11-6-7-12-17(16)21(19)24/h3-7,9-12,18,23H,2,8,13H2,1H3/t18-/m0/s1 |
| InChIKey | ZPTMWLSKXNAIAM-SFHVURJKSA-N |
| XLogP | 4.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|