C20H15ClO4 — CID 53391609
3-[(1R)-1-(2-chlorophenyl)-3-oxobutyl]-4-hydroxynaphthalene-1,2-dione (PubChem CID 53391609) has the molecular formula C20H15ClO4 and a molecular weight of 354.79 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chlorophenyl)-3-oxobutyl]-4-hydroxynaphthalene-1,2-dione.
| Compound Name | 3-[(1R)-1-(2-chlorophenyl)-3-oxobutyl]-4-hydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 53391609 |
| Molecular Formula | C20H15ClO4 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-[(1R)-1-(2-chlorophenyl)-3-oxobutyl]-4-hydroxynaphthalene-1,2-dione |
| SMILES | CC(=O)C[C@H](C1=C(O)c2ccccc2C(=O)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H15ClO4/c1-11(22)10-15(12-6-4-5-9-16(12)21)17-18(23)13-7-2-3-8-14(13)19(24)20(17)25/h2-9,15,23H,10H2,1H3/t15-/m0/s1 |
| InChIKey | LLYZAHAFPFGBLA-HNNXBMFYSA-N |
| XLogP | 4.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|