C24H19NO7 — CID 99994785
methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate (PubChem CID 99994785) has the molecular formula C24H19NO7 and a molecular weight of 433.42 g/mol. Its IUPAC name is methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate.
| Compound Name | methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate |
|---|---|
| PubChem CID | 99994785 |
| Molecular Formula | C24H19NO7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate |
| SMILES | COC(=O)C[C@@H](C1=C(O)c2ccccc2C(=O)C1=O)c1cc2cc(OC)ccc2[nH]c1=O |
| InChI | InChI=1S/C24H19NO7/c1-31-13-7-8-18-12(9-13)10-17(24(30)25-18)16(11-19(26)32-2)20-21(27)14-5-3-4-6-15(14)22(28)23(20)29/h3-10,16,27H,11H2,1-2H3,(H,25,30)/t16-/m1/s1 |
| InChIKey | IYZINKOHXDOFFD-MRXNPFEDSA-N |
| XLogP | 2.92 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|