C24H17NO8 — CID 99994063
methyl (3R)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)propanoate (PubChem CID 99994063) has the molecular formula C24H17NO8 and a molecular weight of 447.40 g/mol. Its IUPAC name is methyl (3R)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)propanoate.
| Compound Name | methyl (3R)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)propanoate |
|---|---|
| PubChem CID | 99994063 |
| Molecular Formula | C24H17NO8 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | methyl (3R)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)propanoate |
| SMILES | COC(=O)C[C@H](C1=C(O)c2ccccc2C(=O)C1=O)c1cc2cc3c(cc2[nH]c1=O)OCO3 |
| InChI | InChI=1S/C24H17NO8/c1-31-19(26)8-14(20-21(27)12-4-2-3-5-13(12)22(28)23(20)29)15-6-11-7-17-18(33-10-32-17)9-16(11)25-24(15)30/h2-7,9,14,27H,8,10H2,1H3,(H,25,30)/t14-/m0/s1 |
| InChIKey | CLDNMMAQHQCHHB-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|