About methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate
methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate (PubChem CID 91636507) has the molecular formula C24H18O8
and a molecular weight of 434.40 g/mol. Its IUPAC name is methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate |
| PubChem CID | 91636507 |
| Molecular Formula | C24H18O8 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate |
| SMILES | COC(=O)CC(C1=C(O)c2ccccc2C(=O)C1=O)c1coc2ccc(OC)cc2c1=O |
| InChI | InChI=1S/C24H18O8/c1-30-12-7-8-18-16(9-12)21(26)17(11-32-18)15(10-19(25)31-2)20-22(27)13-5-3-4-6-14(13)23(28)24(20)29/h3-9,11,15,27H,10H2,1-2H3 |
| InChIKey | VKOPWOGFMIOMSZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate?
The IUPAC name of methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate (CID 91636507) is methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate.
What is the SMILES notation for methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate?
The canonical SMILES for methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate is COC(=O)CC(C1=C(O)c2ccccc2C(=O)C1=O)c1coc2ccc(OC)cc2c1=O.
What is the InChIKey of methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate?
The InChIKey is VKOPWOGFMIOMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O8/c1-30-12-7-8-18-16(9-12)21(26)17(11-32-18)15(10-19(25)31-2)20-22(27)13-5-3-4-6-14(13)23(28)24(20)29/h3-9,11,15,27H,10H2,1-2H3.
What are the key properties of methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate?
methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate has a molecular weight of 434.40 g/mol, XLogP of 3.18, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(6-methoxy-4-oxochromen-3-yl)propanoate is sourced from PubChem (CID 91636507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).