C28H27NO9 — CID 124877041
methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-4-oxochromen-3-yl)propanoate (PubChem CID 124877041) has the molecular formula C28H27NO9 and a molecular weight of 521.52 g/mol. Its IUPAC name is methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-4-oxochromen-3-yl)propanoate.
| Compound Name | methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-4-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 124877041 |
| Molecular Formula | C28H27NO9 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-4-oxochromen-3-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1coc2ccc(OC)cc2c1=O)c1c(O)cc(C)n(CCc2ccc(O)c(O)c2)c1=O |
| InChI | InChI=1S/C28H27NO9/c1-15-10-23(32)26(28(35)29(15)9-8-16-4-6-21(30)22(31)11-16)18(13-25(33)37-3)20-14-38-24-7-5-17(36-2)12-19(24)27(20)34/h4-7,10-12,14,18,30-32H,8-9,13H2,1-3H3/t18-/m0/s1 |
| InChIKey | HSQVCHRJMRDBBN-SFHVURJKSA-N |
| XLogP | 3.33 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|