C32H35N3O8 — CID 125122720
methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-2-morpholin-4-ylquinolin-3-yl)propanoate (PubChem CID 125122720) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-2-morpholin-4-ylquinolin-3-yl)propanoate.
| Compound Name | methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-2-morpholin-4-ylquinolin-3-yl)propanoate |
|---|---|
| PubChem CID | 125122720 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | methyl (3S)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(6-methoxy-2-morpholin-4-ylquinolin-3-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1cc2cc(OC)ccc2nc1N1CCOCC1)c1c(O)cc(C)n(CCc2ccc(O)c(O)c2)c1=O |
| InChI | InChI=1S/C32H35N3O8/c1-19-14-28(38)30(32(40)35(19)9-8-20-4-7-26(36)27(37)15-20)23(18-29(39)42-3)24-17-21-16-22(41-2)5-6-25(21)33-31(24)34-10-12-43-13-11-34/h4-7,14-17,23,36-38H,8-13,18H2,1-3H3/t23-/m0/s1 |
| InChIKey | NZMPOWXUJXMLQX-QHCPKHFHSA-N |
| XLogP | 3.60 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|