C27H24ClNO8 — CID 124876779
methyl (3R)-3-(6-chloro-4-oxochromen-3-yl)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]propanoate (PubChem CID 124876779) has the molecular formula C27H24ClNO8 and a molecular weight of 525.94 g/mol. Its IUPAC name is methyl (3R)-3-(6-chloro-4-oxochromen-3-yl)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]propanoate.
| Compound Name | methyl (3R)-3-(6-chloro-4-oxochromen-3-yl)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 124876779 |
| Molecular Formula | C27H24ClNO8 |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | methyl (3R)-3-(6-chloro-4-oxochromen-3-yl)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]propanoate |
| SMILES | COC(=O)C[C@H](c1coc2ccc(Cl)cc2c1=O)c1c(O)cc(C)n(CCc2ccc(O)c(O)c2)c1=O |
| InChI | InChI=1S/C27H24ClNO8/c1-14-9-22(32)25(27(35)29(14)8-7-15-3-5-20(30)21(31)10-15)17(12-24(33)36-2)19-13-37-23-6-4-16(28)11-18(23)26(19)34/h3-6,9-11,13,17,30-32H,7-8,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | HBBQPYGAWQFLRT-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|