C29H30N2O8 — CID 110206094
methyl 3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)propanoate (PubChem CID 110206094) has the molecular formula C29H30N2O8 and a molecular weight of 534.57 g/mol. Its IUPAC name is methyl 3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)propanoate.
| Compound Name | methyl 3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)propanoate |
|---|---|
| PubChem CID | 110206094 |
| Molecular Formula | C29H30N2O8 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | methyl 3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)propanoate |
| SMILES | COC(=O)CC(c1c(O)cc(C)n(CCc2ccc(O)c(O)c2)c1=O)c1cc2ccc(OC)cc2n(C)c1=O |
| InChI | InChI=1S/C29H30N2O8/c1-16-11-25(34)27(29(37)31(16)10-9-17-5-8-23(32)24(33)12-17)20(15-26(35)39-4)21-13-18-6-7-19(38-3)14-22(18)30(2)28(21)36/h5-8,11-14,20,32-34H,9-10,15H2,1-4H3 |
| InChIKey | UHCCBGASWMXMNQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|