C25H27NO8 — CID 124878769
methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(3-hydroxy-4-methoxyphenyl)propanoate (PubChem CID 124878769) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(3-hydroxy-4-methoxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(3-hydroxy-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 124878769 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(3-hydroxy-4-methoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](c1ccc(OC)c(O)c1)c1c(O)cc(C)n(CCc2ccc(O)c(O)c2)c1=O |
| InChI | InChI=1S/C25H27NO8/c1-14-10-21(30)24(25(32)26(14)9-8-15-4-6-18(27)19(28)11-15)17(13-23(31)34-3)16-5-7-22(33-2)20(29)12-16/h4-7,10-12,17,27-30H,8-9,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | MWZMAIKPZBHMDU-QGZVFWFLSA-N |
| XLogP | 2.93 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|