C27H27N3O6 — CID 124876131
methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(5-phenyl-1H-pyrazol-4-yl)propanoate (PubChem CID 124876131) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(5-phenyl-1H-pyrazol-4-yl)propanoate.
| Compound Name | methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(5-phenyl-1H-pyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 124876131 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | methyl (3R)-3-[1-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxy-6-methyl-2-oxo-3-pyridinyl]-3-(5-phenyl-1H-pyrazol-4-yl)propanoate |
| SMILES | COC(=O)C[C@H](c1cn[nH]c1-c1ccccc1)c1c(O)cc(C)n(CCc2ccc(O)c(O)c2)c1=O |
| InChI | InChI=1S/C27H27N3O6/c1-16-12-23(33)25(27(35)30(16)11-10-17-8-9-21(31)22(32)13-17)19(14-24(34)36-2)20-15-28-29-26(20)18-6-4-3-5-7-18/h3-9,12-13,15,19,31-33H,10-11,14H2,1-2H3,(H,28,29)/t19-/m1/s1 |
| InChIKey | FBZOCNTWDDGZAP-LJQANCHMSA-N |
| XLogP | 3.60 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|