C28H24O6 — CID 99990609
methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-[4-(2-phenylethoxy)phenyl]propanoate (PubChem CID 99990609) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-[4-(2-phenylethoxy)phenyl]propanoate.
| Compound Name | methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-[4-(2-phenylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 99990609 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | methyl (3S)-3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-[4-(2-phenylethoxy)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](C1=C(O)c2ccccc2C(=O)C1=O)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O6/c1-33-24(29)17-23(25-26(30)21-9-5-6-10-22(21)27(31)28(25)32)19-11-13-20(14-12-19)34-16-15-18-7-3-2-4-8-18/h2-14,23,30H,15-17H2,1H3/t23-/m0/s1 |
| InChIKey | PJAFHYKEVUOOGZ-QHCPKHFHSA-N |
| XLogP | 4.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|