C24H22N2O8 — CID 99998573
methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-pyridin-4-ylpropyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-pyridin-4-ylpropanoate (PubChem CID 99998573) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-pyridin-4-ylpropyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-pyridin-4-ylpropanoate.
| Compound Name | methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-pyridin-4-ylpropyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-pyridin-4-ylpropanoate |
|---|---|
| PubChem CID | 99998573 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-pyridin-4-ylpropyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-pyridin-4-ylpropanoate |
| SMILES | COC(=O)C[C@@H](C1=C(O)C(=O)C([C@H](CC(=O)OC)c2ccncc2)=C(O)C1=O)c1ccncc1 |
| InChI | InChI=1S/C24H22N2O8/c1-33-17(27)11-15(13-3-7-25-8-4-13)19-21(29)23(31)20(24(32)22(19)30)16(12-18(28)34-2)14-5-9-26-10-6-14/h3-10,15-16,29,32H,11-12H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | KXXNZKFFIBNECV-HZPDHXFCSA-N |
| XLogP | 2.25 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|