C30H28O12 — CID 99998061
methyl (3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-3-oxopropyl]-2,5-dihydroxy-3,6-dioxocyclohexa-1,4-dien-1-yl]propanoate (PubChem CID 99998061) has the molecular formula C30H28O12 and a molecular weight of 580.54 g/mol. Its IUPAC name is methyl (3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-3-oxopropyl]-2,5-dihydroxy-3,6-dioxocyclohexa-1,4-dien-1-yl]propanoate.
| Compound Name | methyl (3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-3-oxopropyl]-2,5-dihydroxy-3,6-dioxocyclohexa-1,4-dien-1-yl]propanoate |
|---|---|
| PubChem CID | 99998061 |
| Molecular Formula | C30H28O12 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | methyl (3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[4-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-3-oxopropyl]-2,5-dihydroxy-3,6-dioxocyclohexa-1,4-dien-1-yl]propanoate |
| SMILES | COC(=O)C[C@@H](C1=C(O)C(=O)C([C@H](CC(=O)OC)c2ccc3c(c2)OCCO3)=C(O)C1=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C30H28O12/c1-37-23(31)13-17(15-3-5-19-21(11-15)41-9-7-39-19)25-27(33)29(35)26(30(36)28(25)34)18(14-24(32)38-2)16-4-6-20-22(12-16)42-10-8-40-20/h3-6,11-12,17-18,33,36H,7-10,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | CCRBSYCGOZFJCO-QZTJIDSGSA-N |
| XLogP | 3.00 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|