methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate

C15H21NO4 — CID 66097936

IUPACmethyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate
SMILESCCC(N)C(CC(=O)OC)c1ccc2c(c1)OCCO2
InChIInChI=1S/C15H21NO4/c1-3-12(16)11(9-15(17)18-2)10-4-5-13-14(8-10)20-7-6-19-13/h4-5,8,11-12H,3,6-7,9,16H2,1-2H3
InChIKeyRQNBXQDIJCYMHV-UHFFFAOYSA-N
MW279.34 g/mol
LogP1.84
Rot. Bonds5

About methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate

methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate (PubChem CID 66097936) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate.

Molecular Properties

Compound Namemethyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate
PubChem CID66097936
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Namemethyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate
SMILESCCC(N)C(CC(=O)OC)c1ccc2c(c1)OCCO2
InChIInChI=1S/C15H21NO4/c1-3-12(16)11(9-15(17)18-2)10-4-5-13-14(8-10)20-7-6-19-13/h4-5,8,11-12H,3,6-7,9,16H2,1-2H3
InChIKeyRQNBXQDIJCYMHV-UHFFFAOYSA-N
XLogP1.84
TPSA70.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate?
The IUPAC name of methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate (CID 66097936) is methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate.
What is the SMILES notation for methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate?
The canonical SMILES for methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate is CCC(N)C(CC(=O)OC)c1ccc2c(c1)OCCO2.
What is the InChIKey of methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate?
The InChIKey is RQNBXQDIJCYMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-3-12(16)11(9-15(17)18-2)10-4-5-13-14(8-10)20-7-6-19-13/h4-5,8,11-12H,3,6-7,9,16H2,1-2H3.
What are the key properties of methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate?
methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate has a molecular weight of 279.34 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate is sourced from PubChem (CID 66097936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).