C32H36O14 — CID 99999484
methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-(2,4,5-trimethoxyphenyl)propyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-(2,4,5-trimethoxyphenyl)propanoate (PubChem CID 99999484) has the molecular formula C32H36O14 and a molecular weight of 644.63 g/mol. Its IUPAC name is methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-(2,4,5-trimethoxyphenyl)propyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-(2,4,5-trimethoxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-(2,4,5-trimethoxyphenyl)propyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-(2,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 99999484 |
| Molecular Formula | C32H36O14 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | methyl (3R)-3-[2,5-dihydroxy-4-[(1R)-3-methoxy-3-oxo-1-(2,4,5-trimethoxyphenyl)propyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-(2,4,5-trimethoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@@H](C1=C(O)C(=O)C([C@H](CC(=O)OC)c2cc(OC)c(OC)cc2OC)=C(O)C1=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C32H36O14/c1-39-19-13-23(43-5)21(41-3)9-15(19)17(11-25(33)45-7)27-29(35)31(37)28(32(38)30(27)36)18(12-26(34)46-8)16-10-22(42-4)24(44-6)14-20(16)40-2/h9-10,13-14,17-18,35,38H,11-12H2,1-8H3/t17-,18-/m1/s1 |
| InChIKey | HVDKRQXKVIRKEH-QZTJIDSGSA-N |
| XLogP | 3.51 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|