C32H26N2O8 — CID 102564510
methyl 3-[2,5-dihydroxy-4-(3-methoxy-3-oxo-1-quinolin-4-ylpropyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-quinolin-4-ylpropanoate (PubChem CID 102564510) has the molecular formula C32H26N2O8 and a molecular weight of 566.57 g/mol. Its IUPAC name is methyl 3-[2,5-dihydroxy-4-(3-methoxy-3-oxo-1-quinolin-4-ylpropyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-quinolin-4-ylpropanoate.
| Compound Name | methyl 3-[2,5-dihydroxy-4-(3-methoxy-3-oxo-1-quinolin-4-ylpropyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-quinolin-4-ylpropanoate |
|---|---|
| PubChem CID | 102564510 |
| Molecular Formula | C32H26N2O8 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | methyl 3-[2,5-dihydroxy-4-(3-methoxy-3-oxo-1-quinolin-4-ylpropyl)-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-quinolin-4-ylpropanoate |
| SMILES | COC(=O)CC(C1=C(O)C(=O)C(C(CC(=O)OC)c2ccnc3ccccc23)=C(O)C1=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C32H26N2O8/c1-41-25(35)15-21(17-11-13-33-23-9-5-3-7-19(17)23)27-29(37)31(39)28(32(40)30(27)38)22(16-26(36)42-2)18-12-14-34-24-10-6-4-8-20(18)24/h3-14,21-22,37,40H,15-16H2,1-2H3 |
| InChIKey | UMPQYZBNWXZNRS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|