C31H28NO4+ — CID 164681441
(2S)-1-[(E,5S)-5-(1-hydroxy-3-oxoinden-2-yl)-1,5-diphenylpent-1-en-3-ylidene]pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 164681441) has the molecular formula C31H28NO4+ and a molecular weight of 478.57 g/mol. Its IUPAC name is (2S)-1-[(E,5S)-5-(1-hydroxy-3-oxoinden-2-yl)-1,5-diphenylpent-1-en-3-ylidene]pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-1-[(E,5S)-5-(1-hydroxy-3-oxoinden-2-yl)-1,5-diphenylpent-1-en-3-ylidene]pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 164681441 |
| Molecular Formula | C31H28NO4+ |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2S)-1-[(E,5S)-5-(1-hydroxy-3-oxoinden-2-yl)-1,5-diphenylpent-1-en-3-ylidene]pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | O=C1C([C@@H](CC(/C=C/c2ccccc2)=[N+]2/CCC[C@H]2C(=O)O)c2ccccc2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C31H27NO4/c33-29-24-14-7-8-15-25(24)30(34)28(29)26(22-12-5-2-6-13-22)20-23(18-17-21-10-3-1-4-11-21)32-19-9-16-27(32)31(35)36/h1-8,10-15,17-18,26-27H,9,16,19-20H2,(H-,33,34,35,36)/p+1/b18-17+,32-23-/t26-,27-/m0/s1 |
| InChIKey | SZJWMOIIFXDAHJ-PKFIBOJYSA-O |
| XLogP | 5.74 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|